C16H22ClNO3 — CID 79052318
1-(5-chloro-2-methoxyphenyl)-3-methyl-3-morpholin-4-ylbutan-2-one (PubChem CID 79052318) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-methyl-3-morpholin-4-ylbutan-2-one.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-methyl-3-morpholin-4-ylbutan-2-one |
|---|---|
| PubChem CID | 79052318 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-methyl-3-morpholin-4-ylbutan-2-one |
| SMILES | COc1ccc(Cl)cc1CC(=O)C(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C16H22ClNO3/c1-16(2,18-6-8-21-9-7-18)15(19)11-12-10-13(17)4-5-14(12)20-3/h4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | NPXWSFDVGSLCAC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |