C16H23NO — CID 124515845
(S)-phenyl-(1-pyrrolidin-1-ylcyclopentyl)methanol (PubChem CID 124515845) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (S)-phenyl-(1-pyrrolidin-1-ylcyclopentyl)methanol.
| Compound Name | (S)-phenyl-(1-pyrrolidin-1-ylcyclopentyl)methanol |
|---|---|
| PubChem CID | 124515845 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (S)-phenyl-(1-pyrrolidin-1-ylcyclopentyl)methanol |
| SMILES | O[C@@H](c1ccccc1)C1(N2CCCC2)CCCC1 |
| InChI | InChI=1S/C16H23NO/c18-15(14-8-2-1-3-9-14)16(10-4-5-11-16)17-12-6-7-13-17/h1-3,8-9,15,18H,4-7,10-13H2/t15-/m0/s1 |
| InChIKey | UXXMWGUOPQVHCK-HNNXBMFYSA-N |
| XLogP | 3.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |