C23H26Cl2N2O — CID 59347911
2,6-dichloro-N-[phenyl-(1-pyrrolidin-1-ylcyclopentyl)methyl]benzamide (PubChem CID 59347911) has the molecular formula C23H26Cl2N2O and a molecular weight of 417.38 g/mol. Its IUPAC name is 2,6-dichloro-N-[phenyl-(1-pyrrolidin-1-ylcyclopentyl)methyl]benzamide.
| Compound Name | 2,6-dichloro-N-[phenyl-(1-pyrrolidin-1-ylcyclopentyl)methyl]benzamide |
|---|---|
| PubChem CID | 59347911 |
| Molecular Formula | C23H26Cl2N2O |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2,6-dichloro-N-[phenyl-(1-pyrrolidin-1-ylcyclopentyl)methyl]benzamide |
| SMILES | O=C(NC(c1ccccc1)C1(N2CCCC2)CCCC1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H26Cl2N2O/c24-18-11-8-12-19(25)20(18)22(28)26-21(17-9-2-1-3-10-17)23(13-4-5-14-23)27-15-6-7-16-27/h1-3,8-12,21H,4-7,13-16H2,(H,26,28) |
| InChIKey | BXNWJSHQOYTWRZ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |