C21H23Cl3N2O — CID 59347870
2,3,6-trichloro-N-[[1-(dimethylamino)cyclopentyl]-phenylmethyl]benzamide (PubChem CID 59347870) has the molecular formula C21H23Cl3N2O and a molecular weight of 425.79 g/mol. Its IUPAC name is 2,3,6-trichloro-N-[[1-(dimethylamino)cyclopentyl]-phenylmethyl]benzamide.
| Compound Name | 2,3,6-trichloro-N-[[1-(dimethylamino)cyclopentyl]-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 59347870 |
| Molecular Formula | C21H23Cl3N2O |
| Molecular Weight | 425.79 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 2,3,6-trichloro-N-[[1-(dimethylamino)cyclopentyl]-phenylmethyl]benzamide |
| SMILES | CN(C)C1(C(NC(=O)c2c(Cl)ccc(Cl)c2Cl)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C21H23Cl3N2O/c1-26(2)21(12-6-7-13-21)19(14-8-4-3-5-9-14)25-20(27)17-15(22)10-11-16(23)18(17)24/h3-5,8-11,19H,6-7,12-13H2,1-2H3,(H,25,27) |
| InChIKey | MNKFWCCJNFOTJE-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.79 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|