C24H27N3O — CID 11516293
N-[[1-(dimethylamino)cyclopentyl]-phenylmethyl]quinoline-4-carboxamide (PubChem CID 11516293) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cyclopentyl]-phenylmethyl]quinoline-4-carboxamide.
| Compound Name | N-[[1-(dimethylamino)cyclopentyl]-phenylmethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 11516293 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | N-[[1-(dimethylamino)cyclopentyl]-phenylmethyl]quinoline-4-carboxamide |
| SMILES | CN(C)C1(C(NC(=O)c2ccnc3ccccc23)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C24H27N3O/c1-27(2)24(15-8-9-16-24)22(18-10-4-3-5-11-18)26-23(28)20-14-17-25-21-13-7-6-12-19(20)21/h3-7,10-14,17,22H,8-9,15-16H2,1-2H3,(H,26,28) |
| InChIKey | DHBPXAWICFVAJT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |