C26H28F3N3O — CID 11576123
N-[[1-(dimethylamino)cyclohexyl]-phenylmethyl]-2-(trifluoromethyl)quinoline-4-carboxamide (PubChem CID 11576123) has the molecular formula C26H28F3N3O and a molecular weight of 455.52 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cyclohexyl]-phenylmethyl]-2-(trifluoromethyl)quinoline-4-carboxamide.
| Compound Name | N-[[1-(dimethylamino)cyclohexyl]-phenylmethyl]-2-(trifluoromethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 11576123 |
| Molecular Formula | C26H28F3N3O |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | N-[[1-(dimethylamino)cyclohexyl]-phenylmethyl]-2-(trifluoromethyl)quinoline-4-carboxamide |
| SMILES | CN(C)C1(C(NC(=O)c2cc(C(F)(F)F)nc3ccccc23)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C26H28F3N3O/c1-32(2)25(15-9-4-10-16-25)23(18-11-5-3-6-12-18)31-24(33)20-17-22(26(27,28)29)30-21-14-8-7-13-19(20)21/h3,5-8,11-14,17,23H,4,9-10,15-16H2,1-2H3,(H,31,33) |
| InChIKey | WNXWOGIQPXOVTI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |