C27H30F3N3O — CID 11669990
N-[[1-(diethylamino)cyclopentyl]-phenylmethyl]-2-(trifluoromethyl)quinoline-4-carboxamide (PubChem CID 11669990) has the molecular formula C27H30F3N3O and a molecular weight of 469.55 g/mol. Its IUPAC name is N-[[1-(diethylamino)cyclopentyl]-phenylmethyl]-2-(trifluoromethyl)quinoline-4-carboxamide.
| Compound Name | N-[[1-(diethylamino)cyclopentyl]-phenylmethyl]-2-(trifluoromethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 11669990 |
| Molecular Formula | C27H30F3N3O |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | N-[[1-(diethylamino)cyclopentyl]-phenylmethyl]-2-(trifluoromethyl)quinoline-4-carboxamide |
| SMILES | CCN(CC)C1(C(NC(=O)c2cc(C(F)(F)F)nc3ccccc23)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C27H30F3N3O/c1-3-33(4-2)26(16-10-11-17-26)24(19-12-6-5-7-13-19)32-25(34)21-18-23(27(28,29)30)31-22-15-9-8-14-20(21)22/h5-9,12-15,18,24H,3-4,10-11,16-17H2,1-2H3,(H,32,34) |
| InChIKey | XYNVIJYVOVNRCQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |