C22H28N2OS — CID 11537937
N-[[1-(dimethylamino)cyclopentyl]-phenylmethyl]-2-methylsulfanylbenzamide (PubChem CID 11537937) has the molecular formula C22H28N2OS and a molecular weight of 368.55 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cyclopentyl]-phenylmethyl]-2-methylsulfanylbenzamide.
| Compound Name | N-[[1-(dimethylamino)cyclopentyl]-phenylmethyl]-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 11537937 |
| Molecular Formula | C22H28N2OS |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | N-[[1-(dimethylamino)cyclopentyl]-phenylmethyl]-2-methylsulfanylbenzamide |
| SMILES | CSc1ccccc1C(=O)NC(c1ccccc1)C1(N(C)C)CCCC1 |
| InChI | InChI=1S/C22H28N2OS/c1-24(2)22(15-9-10-16-22)20(17-11-5-4-6-12-17)23-21(25)18-13-7-8-14-19(18)26-3/h4-8,11-14,20H,9-10,15-16H2,1-3H3,(H,23,25) |
| InChIKey | FXOIRSHTSKUCHZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |