About 1-[(R)-[(2,6-dimethylbenzoyl)amino]-phenylmethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylic acid
1-[(R)-[(2,6-dimethylbenzoyl)amino]-phenylmethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylic acid (PubChem CID 141278623) has the molecular formula C23H26N2O3
and a molecular weight of 378.47 g/mol. Its IUPAC name is 1-[(R)-[(2,6-dimethylbenzoyl)amino]-phenylmethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(R)-[(2,6-dimethylbenzoyl)amino]-phenylmethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylic acid |
| PubChem CID | 141278623 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1-[(R)-[(2,6-dimethylbenzoyl)amino]-phenylmethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylic acid |
| SMILES | Cc1cccc(C)c1C(=O)N[C@H](c1ccccc1)C12CCC(CC1)N2C(=O)O |
| InChI | InChI=1S/C23H26N2O3/c1-15-7-6-8-16(2)19(15)21(26)24-20(17-9-4-3-5-10-17)23-13-11-18(12-14-23)25(23)22(27)28/h3-10,18,20H,11-14H2,1-2H3,(H,24,26)(H,27,28)/t18?,20-,23?/m1/s1 |
| InChIKey | BDPDPMDIVDQCKT-WRSRUZKNSA-N |
| XLogP | 4.45 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(R)-[(2,6-dimethylbenzoyl)amino]-phenylmethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(R)-[(2,6-dimethylbenzoyl)amino]-phenylmethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylic acid?
The IUPAC name of 1-[(R)-[(2,6-dimethylbenzoyl)amino]-phenylmethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylic acid (CID 141278623) is 1-[(R)-[(2,6-dimethylbenzoyl)amino]-phenylmethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylic acid.
What is the SMILES notation for 1-[(R)-[(2,6-dimethylbenzoyl)amino]-phenylmethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylic acid?
The canonical SMILES for 1-[(R)-[(2,6-dimethylbenzoyl)amino]-phenylmethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylic acid is Cc1cccc(C)c1C(=O)N[C@H](c1ccccc1)C12CCC(CC1)N2C(=O)O.
What is the InChIKey of 1-[(R)-[(2,6-dimethylbenzoyl)amino]-phenylmethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylic acid?
The InChIKey is BDPDPMDIVDQCKT-WRSRUZKNSA-N. The full InChI is InChI=1S/C23H26N2O3/c1-15-7-6-8-16(2)19(15)21(26)24-20(17-9-4-3-5-10-17)23-13-11-18(12-14-23)25(23)22(27)28/h3-10,18,20H,11-14H2,1-2H3,(H,24,26)(H,27,28)/t18?,20-,23?/m1/s1.
What are the key properties of 1-[(R)-[(2,6-dimethylbenzoyl)amino]-phenylmethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylic acid?
1-[(R)-[(2,6-dimethylbenzoyl)amino]-phenylmethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylic acid has a molecular weight of 378.47 g/mol, XLogP of 4.45, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(R)-[(2,6-dimethylbenzoyl)amino]-phenylmethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylic acid is sourced from PubChem (CID 141278623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).