About 2-[[(3S)-2,3-dihydro-1-benzothiophene-3-carbonyl]-(2-methoxyethyl)amino]acetic acid
2-[[(3S)-2,3-dihydro-1-benzothiophene-3-carbonyl]-(2-methoxyethyl)amino]acetic acid (PubChem CID 124516113) has the molecular formula C14H17NO4S
and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-[[(3S)-2,3-dihydro-1-benzothiophene-3-carbonyl]-(2-methoxyethyl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[(3S)-2,3-dihydro-1-benzothiophene-3-carbonyl]-(2-methoxyethyl)amino]acetic acid |
| PubChem CID | 124516113 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-[[(3S)-2,3-dihydro-1-benzothiophene-3-carbonyl]-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)[C@H]1CSc2ccccc21 |
| InChI | InChI=1S/C14H17NO4S/c1-19-7-6-15(8-13(16)17)14(18)11-9-20-12-5-3-2-4-10(11)12/h2-5,11H,6-9H2,1H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | CMBJJDMCSXGWKV-NSHDSACASA-N |
| XLogP | 1.44 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[(3S)-2,3-dihydro-1-benzothiophene-3-carbonyl]-(2-methoxyethyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3S)-2,3-dihydro-1-benzothiophene-3-carbonyl]-(2-methoxyethyl)amino]acetic acid?
The IUPAC name of 2-[[(3S)-2,3-dihydro-1-benzothiophene-3-carbonyl]-(2-methoxyethyl)amino]acetic acid (CID 124516113) is 2-[[(3S)-2,3-dihydro-1-benzothiophene-3-carbonyl]-(2-methoxyethyl)amino]acetic acid.
What is the SMILES notation for 2-[[(3S)-2,3-dihydro-1-benzothiophene-3-carbonyl]-(2-methoxyethyl)amino]acetic acid?
The canonical SMILES for 2-[[(3S)-2,3-dihydro-1-benzothiophene-3-carbonyl]-(2-methoxyethyl)amino]acetic acid is COCCN(CC(=O)O)C(=O)[C@H]1CSc2ccccc21.
What is the InChIKey of 2-[[(3S)-2,3-dihydro-1-benzothiophene-3-carbonyl]-(2-methoxyethyl)amino]acetic acid?
The InChIKey is CMBJJDMCSXGWKV-NSHDSACASA-N. The full InChI is InChI=1S/C14H17NO4S/c1-19-7-6-15(8-13(16)17)14(18)11-9-20-12-5-3-2-4-10(11)12/h2-5,11H,6-9H2,1H3,(H,16,17)/t11-/m0/s1.
What are the key properties of 2-[[(3S)-2,3-dihydro-1-benzothiophene-3-carbonyl]-(2-methoxyethyl)amino]acetic acid?
2-[[(3S)-2,3-dihydro-1-benzothiophene-3-carbonyl]-(2-methoxyethyl)amino]acetic acid has a molecular weight of 295.36 g/mol, XLogP of 1.44, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3S)-2,3-dihydro-1-benzothiophene-3-carbonyl]-(2-methoxyethyl)amino]acetic acid is sourced from PubChem (CID 124516113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).