C14H18N2O — CID 124516636
(3R)-4-[(3,4-dimethylphenyl)methyl]morpholine-3-carbonitrile (PubChem CID 124516636) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is (3R)-4-[(3,4-dimethylphenyl)methyl]morpholine-3-carbonitrile.
| Compound Name | (3R)-4-[(3,4-dimethylphenyl)methyl]morpholine-3-carbonitrile |
|---|---|
| PubChem CID | 124516636 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (3R)-4-[(3,4-dimethylphenyl)methyl]morpholine-3-carbonitrile |
| SMILES | Cc1ccc(CN2CCOC[C@H]2C#N)cc1C |
| InChI | InChI=1S/C14H18N2O/c1-11-3-4-13(7-12(11)2)9-16-5-6-17-10-14(16)8-15/h3-4,7,14H,5-6,9-10H2,1-2H3/t14-/m1/s1 |
| InChIKey | LCIPVEYULYZUJO-CQSZACIVSA-N |
| XLogP | 2.03 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |