C15H19N5OS — CID 124520148
2-[[(7R,8aR)-7-pyrimidin-5-yloxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-1,3-thiazole (PubChem CID 124520148) has the molecular formula C15H19N5OS and a molecular weight of 317.42 g/mol. Its IUPAC name is 2-[[(7R,8aR)-7-pyrimidin-5-yloxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[[(7R,8aR)-7-pyrimidin-5-yloxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 124520148 |
| Molecular Formula | C15H19N5OS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-[[(7R,8aR)-7-pyrimidin-5-yloxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-1,3-thiazole |
| SMILES | c1ncc(O[C@@H]2C[C@@H]3CN(Cc4nccs4)CCN3C2)cn1 |
| InChI | InChI=1S/C15H19N5OS/c1-4-22-15(18-1)10-19-2-3-20-9-13(5-12(20)8-19)21-14-6-16-11-17-7-14/h1,4,6-7,11-13H,2-3,5,8-10H2/t12-,13-/m1/s1 |
| InChIKey | VUFOFFZRZXYDCE-CHWSQXEVSA-N |
| XLogP | 1.27 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |