C20H24O4 — CID 124525201
dimethyl (1'S,3'R,6'R,8'S)-12',12'-dimethylspiro[cyclopropane-1,11'-tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene]-4',5'-dicarboxylate (PubChem CID 124525201) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is dimethyl (1'S,3'R,6'R,8'S)-12',12'-dimethylspiro[cyclopropane-1,11'-tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene]-4',5'-dicarboxylate.
| Compound Name | dimethyl (1'S,3'R,6'R,8'S)-12',12'-dimethylspiro[cyclopropane-1,11'-tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene]-4',5'-dicarboxylate |
|---|---|
| PubChem CID | 124525201 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | dimethyl (1'S,3'R,6'R,8'S)-12',12'-dimethylspiro[cyclopropane-1,11'-tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene]-4',5'-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@H]2C3=C([C@H]1C2(C)C)[C@H]1CC[C@H]3C12CC2 |
| InChI | InChI=1S/C20H24O4/c1-19(2)15-11-9-5-6-10(20(9)7-8-20)12(11)16(19)14(18(22)24-4)13(15)17(21)23-3/h9-10,15-16H,5-8H2,1-4H3/t9-,10-,15-,16-/m1/s1 |
| InChIKey | CRBWCUQLRBNJRK-DJUAPZDMSA-N |
| XLogP | 3.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|