C33H29N3O5 — CID 124533053
methyl 4-[2,5-dimethyl-3-[(E)-[1-(4-methylphenyl)-2,4,6-trioxo-3-phenyl-1,3-diazinan-5-ylidene]methyl]pyrrol-1-yl]-3-methylbenzoate (PubChem CID 124533053) has the molecular formula C33H29N3O5 and a molecular weight of 547.61 g/mol. Its IUPAC name is methyl 4-[2,5-dimethyl-3-[(E)-[1-(4-methylphenyl)-2,4,6-trioxo-3-phenyl-1,3-diazinan-5-ylidene]methyl]pyrrol-1-yl]-3-methylbenzoate.
| Compound Name | methyl 4-[2,5-dimethyl-3-[(E)-[1-(4-methylphenyl)-2,4,6-trioxo-3-phenyl-1,3-diazinan-5-ylidene]methyl]pyrrol-1-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 124533053 |
| Molecular Formula | C33H29N3O5 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | methyl 4-[2,5-dimethyl-3-[(E)-[1-(4-methylphenyl)-2,4,6-trioxo-3-phenyl-1,3-diazinan-5-ylidene]methyl]pyrrol-1-yl]-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(-n2c(C)cc(/C=C3\C(=O)N(c4ccccc4)C(=O)N(c4ccc(C)cc4)C3=O)c2C)c(C)c1 |
| InChI | InChI=1S/C33H29N3O5/c1-20-11-14-27(15-12-20)36-31(38)28(30(37)35(33(36)40)26-9-7-6-8-10-26)19-25-18-22(3)34(23(25)4)29-16-13-24(17-21(29)2)32(39)41-5/h6-19H,1-5H3/b28-19+ |
| InChIKey | XRXYSTQKHGTKJB-TURZUDJPSA-N |
| XLogP | 6.08 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|