C26H22BrN3O5 — CID 124533594
methyl 4-[3-[(E)-[1-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoate (PubChem CID 124533594) has the molecular formula C26H22BrN3O5 and a molecular weight of 536.38 g/mol. Its IUPAC name is methyl 4-[3-[(E)-[1-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoate.
| Compound Name | methyl 4-[3-[(E)-[1-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 124533594 |
| Molecular Formula | C26H22BrN3O5 |
| Molecular Weight | 536.38 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | methyl 4-[3-[(E)-[1-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(-n2c(C)cc(/C=C3\C(=O)NC(=O)N(c4cccc(Br)c4)C3=O)c2C)c(C)c1 |
| InChI | InChI=1S/C26H22BrN3O5/c1-14-10-17(25(33)35-4)8-9-22(14)29-15(2)11-18(16(29)3)12-21-23(31)28-26(34)30(24(21)32)20-7-5-6-19(27)13-20/h5-13H,1-4H3,(H,28,31,34)/b21-12+ |
| InChIKey | NSPHMJLNUBPWTO-CIAFOILYSA-N |
| XLogP | 4.62 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|