C35H35ClN4O2 — CID 124535147
N-[3-[(Z)-N-[[4-[(4-benzylpiperidin-1-yl)methyl]benzoyl]amino]-C-methylcarbonimidoyl]phenyl]-3-chlorobenzamide (PubChem CID 124535147) has the molecular formula C35H35ClN4O2 and a molecular weight of 579.14 g/mol. Its IUPAC name is N-[3-[(Z)-N-[[4-[(4-benzylpiperidin-1-yl)methyl]benzoyl]amino]-C-methylcarbonimidoyl]phenyl]-3-chlorobenzamide.
| Compound Name | N-[3-[(Z)-N-[[4-[(4-benzylpiperidin-1-yl)methyl]benzoyl]amino]-C-methylcarbonimidoyl]phenyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 124535147 |
| Molecular Formula | C35H35ClN4O2 |
| Molecular Weight | 579.14 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | N-[3-[(Z)-N-[[4-[(4-benzylpiperidin-1-yl)methyl]benzoyl]amino]-C-methylcarbonimidoyl]phenyl]-3-chlorobenzamide |
| SMILES | C/C(=N/NC(=O)c1ccc(CN2CCC(Cc3ccccc3)CC2)cc1)c1cccc(NC(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C35H35ClN4O2/c1-25(30-9-6-12-33(23-30)37-34(41)31-10-5-11-32(36)22-31)38-39-35(42)29-15-13-28(14-16-29)24-40-19-17-27(18-20-40)21-26-7-3-2-4-8-26/h2-16,22-23,27H,17-21,24H2,1H3,(H,37,41)(H,39,42)/b38-25- |
| InChIKey | BDJGBJZQLWWYDX-NHXQZRDHSA-N |
| XLogP | 7.20 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.14 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|