C9H22N2 — CID 124537670
[(3S,4S)-2,4-dimethylheptan-3-yl]hydrazine (PubChem CID 124537670) has the molecular formula C9H22N2 and a molecular weight of 158.29 g/mol. Its IUPAC name is [(3S,4S)-2,4-dimethylheptan-3-yl]hydrazine.
| Compound Name | [(3S,4S)-2,4-dimethylheptan-3-yl]hydrazine |
|---|---|
| PubChem CID | 124537670 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | [(3S,4S)-2,4-dimethylheptan-3-yl]hydrazine |
| SMILES | CCC[C@H](C)[C@@H](NN)C(C)C |
| InChI | InChI=1S/C9H22N2/c1-5-6-8(4)9(11-10)7(2)3/h7-9,11H,5-6,10H2,1-4H3/t8-,9-/m0/s1 |
| InChIKey | ONAFQXCHRDEIKA-IUCAKERBSA-N |
| XLogP | 1.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|