C32H28ClN3O5S — CID 124538331
(3aR,4S,9bS)-N-(5-chloro-2-methylphenyl)-4-[4-[(4-nitrophenyl)methoxy]phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 124538331) has the molecular formula C32H28ClN3O5S and a molecular weight of 602.11 g/mol. Its IUPAC name is (3aR,4S,9bS)-N-(5-chloro-2-methylphenyl)-4-[4-[(4-nitrophenyl)methoxy]phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (3aR,4S,9bS)-N-(5-chloro-2-methylphenyl)-4-[4-[(4-nitrophenyl)methoxy]phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 124538331 |
| Molecular Formula | C32H28ClN3O5S |
| Molecular Weight | 602.11 g/mol |
| Exact Mass | 601.14 |
| IUPAC Name | (3aR,4S,9bS)-N-(5-chloro-2-methylphenyl)-4-[4-[(4-nitrophenyl)methoxy]phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | Cc1ccc(Cl)cc1NS(=O)(=O)c1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(OCc3ccc([N+](=O)[O-])cc3)cc1)N2 |
| InChI | InChI=1S/C32H28ClN3O5S/c1-20-5-10-23(33)17-31(20)35-42(39,40)26-15-16-30-29(18-26)27-3-2-4-28(27)32(34-30)22-8-13-25(14-9-22)41-19-21-6-11-24(12-7-21)36(37)38/h2-3,5-18,27-28,32,34-35H,4,19H2,1H3/t27-,28+,32+/m0/s1 |
| InChIKey | ADFOCLCYUPUQOA-YUXUKGBOSA-N |
| XLogP | 7.76 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.11 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|