C29H21BrN2O3S — CID 124538920
[2-[(E)-[(11R)-11-(4-bromophenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]phenyl] acetate (PubChem CID 124538920) has the molecular formula C29H21BrN2O3S and a molecular weight of 557.47 g/mol. Its IUPAC name is [2-[(E)-[(11R)-11-(4-bromophenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]phenyl] acetate.
| Compound Name | [2-[(E)-[(11R)-11-(4-bromophenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 124538920 |
| Molecular Formula | C29H21BrN2O3S |
| Molecular Weight | 557.47 g/mol |
| Exact Mass | 556.05 |
| IUPAC Name | [2-[(E)-[(11R)-11-(4-bromophenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1/C=c1/sc2n(c1=O)[C@H](c1ccc(Br)cc1)C1=C(N=2)c2ccccc2CC1 |
| InChI | InChI=1S/C29H21BrN2O3S/c1-17(33)35-24-9-5-3-7-20(24)16-25-28(34)32-27(19-10-13-21(30)14-11-19)23-15-12-18-6-2-4-8-22(18)26(23)31-29(32)36-25/h2-11,13-14,16,27H,12,15H2,1H3/b25-16+/t27-/m1/s1 |
| InChIKey | KJBUKRCLUNDKPH-QTTRZTASSA-N |
| XLogP | 5.01 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|