C38H28N2O2S — CID 124539338
(11S,14Z)-11-phenyl-14-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124539338) has the molecular formula C38H28N2O2S and a molecular weight of 576.72 g/mol. Its IUPAC name is (11S,14Z)-11-phenyl-14-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S,14Z)-11-phenyl-14-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124539338 |
| Molecular Formula | C38H28N2O2S |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | (11S,14Z)-11-phenyl-14-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | O=c1/c(=C/c2c(OCc3ccccc3)ccc3ccccc23)sc2n1[C@@H](c1ccccc1)C1=C(N=2)c2ccccc2CC1 |
| InChI | InChI=1S/C38H28N2O2S/c41-37-34(23-32-29-17-9-7-13-26(29)20-22-33(32)42-24-25-11-3-1-4-12-25)43-38-39-35-30-18-10-8-14-27(30)19-21-31(35)36(40(37)38)28-15-5-2-6-16-28/h1-18,20,22-23,36H,19,21,24H2/b34-23-/t36-/m0/s1 |
| InChIKey | SMWPQKLSDOORHP-FKIODOFUSA-N |
| XLogP | 7.05 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |