C26H26ClN3O5 — CID 124540802
(3S,3'aR,8'aS,8'bS)-5-chloro-2'-[2-(3,4-dimethoxyphenyl)ethyl]spiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione (PubChem CID 124540802) has the molecular formula C26H26ClN3O5 and a molecular weight of 495.96 g/mol. Its IUPAC name is (3S,3'aR,8'aS,8'bS)-5-chloro-2'-[2-(3,4-dimethoxyphenyl)ethyl]spiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione.
| Compound Name | (3S,3'aR,8'aS,8'bS)-5-chloro-2'-[2-(3,4-dimethoxyphenyl)ethyl]spiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
|---|---|
| PubChem CID | 124540802 |
| Molecular Formula | C26H26ClN3O5 |
| Molecular Weight | 495.96 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | (3S,3'aR,8'aS,8'bS)-5-chloro-2'-[2-(3,4-dimethoxyphenyl)ethyl]spiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
| SMILES | COc1ccc(CCN2C(=O)[C@H]3[C@@H](C2=O)[C@]2(C(=O)Nc4ccc(Cl)cc42)N2CCC[C@@H]32)cc1OC |
| InChI | InChI=1S/C26H26ClN3O5/c1-34-19-8-5-14(12-20(19)35-2)9-11-29-23(31)21-18-4-3-10-30(18)26(22(21)24(29)32)16-13-15(27)6-7-17(16)28-25(26)33/h5-8,12-13,18,21-22H,3-4,9-11H2,1-2H3,(H,28,33)/t18-,21+,22-,26+/m0/s1 |
| InChIKey | KBMFWHVXHYDCLZ-GDNALLQQSA-N |
| XLogP | 2.83 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.96 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|