C20H22N2O3 — CID 124542936
4-[5-[[[(3S)-2,3-dihydro-1-benzofuran-3-yl]amino]methyl]-2-methoxyphenoxy]butanenitrile (PubChem CID 124542936) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-[5-[[[(3S)-2,3-dihydro-1-benzofuran-3-yl]amino]methyl]-2-methoxyphenoxy]butanenitrile.
| Compound Name | 4-[5-[[[(3S)-2,3-dihydro-1-benzofuran-3-yl]amino]methyl]-2-methoxyphenoxy]butanenitrile |
|---|---|
| PubChem CID | 124542936 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 4-[5-[[[(3S)-2,3-dihydro-1-benzofuran-3-yl]amino]methyl]-2-methoxyphenoxy]butanenitrile |
| SMILES | COc1ccc(CN[C@@H]2COc3ccccc32)cc1OCCCC#N |
| InChI | InChI=1S/C20H22N2O3/c1-23-19-9-8-15(12-20(19)24-11-5-4-10-21)13-22-17-14-25-18-7-3-2-6-16(17)18/h2-3,6-9,12,17,22H,4-5,11,13-14H2,1H3/t17-/m1/s1 |
| InChIKey | IQTJZRBJOANGCQ-QGZVFWFLSA-N |
| XLogP | 3.60 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|