C14H21N3O — CID 124547773
(7R,8aS)-7-[(6-methyl-2-pyridinyl)methoxy]-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine (PubChem CID 124547773) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is (7R,8aS)-7-[(6-methyl-2-pyridinyl)methoxy]-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine.
| Compound Name | (7R,8aS)-7-[(6-methyl-2-pyridinyl)methoxy]-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 124547773 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | (7R,8aS)-7-[(6-methyl-2-pyridinyl)methoxy]-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine |
| SMILES | Cc1cccc(CO[C@@H]2C[C@H]3CNCCN3C2)n1 |
| InChI | InChI=1S/C14H21N3O/c1-11-3-2-4-12(16-11)10-18-14-7-13-8-15-5-6-17(13)9-14/h2-4,13-15H,5-10H2,1H3/t13-,14+/m0/s1 |
| InChIKey | PKHHPUDIVMQSLL-UONOGXRCSA-N |
| XLogP | 0.95 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |