C23H27F6N3O6 — CID 171696824
2-(furan-3-ylmethyl)-7-[(6-methyl-2-pyridinyl)methoxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171696824) has the molecular formula C23H27F6N3O6 and a molecular weight of 555.47 g/mol. Its IUPAC name is 2-(furan-3-ylmethyl)-7-[(6-methyl-2-pyridinyl)methoxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-(furan-3-ylmethyl)-7-[(6-methyl-2-pyridinyl)methoxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171696824 |
| Molecular Formula | C23H27F6N3O6 |
| Molecular Weight | 555.47 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | 2-(furan-3-ylmethyl)-7-[(6-methyl-2-pyridinyl)methoxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1cccc(COC2CC3CN(Cc4ccoc4)CCN3C2)n1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H25N3O2.2C2HF3O2/c1-15-3-2-4-17(20-15)14-24-19-9-18-11-21(6-7-22(18)12-19)10-16-5-8-23-13-16;2*3-2(4,5)1(6)7/h2-5,8,13,18-19H,6-7,9-12,14H2,1H3;2*(H,6,7) |
| InChIKey | RWPXFBIGPMGJTR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |