C17H17ClN2O4 — CID 124557642
(2S)-N-(3-chloro-4-hydroxyphenyl)-2-[(2-phenoxyacetyl)amino]propanamide (PubChem CID 124557642) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is (2S)-N-(3-chloro-4-hydroxyphenyl)-2-[(2-phenoxyacetyl)amino]propanamide.
| Compound Name | (2S)-N-(3-chloro-4-hydroxyphenyl)-2-[(2-phenoxyacetyl)amino]propanamide |
|---|---|
| PubChem CID | 124557642 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (2S)-N-(3-chloro-4-hydroxyphenyl)-2-[(2-phenoxyacetyl)amino]propanamide |
| SMILES | C[C@H](NC(=O)COc1ccccc1)C(=O)Nc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C17H17ClN2O4/c1-11(17(23)20-12-7-8-15(21)14(18)9-12)19-16(22)10-24-13-5-3-2-4-6-13/h2-9,11,21H,10H2,1H3,(H,19,22)(H,20,23)/t11-/m0/s1 |
| InChIKey | VNTOKCWDRZQSDE-NSHDSACASA-N |
| XLogP | 2.57 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|