C21H24N4O2 — CID 124558496
(1R,2R,4S)-N-[3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl]phenyl]-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 124558496) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is (1R,2R,4S)-N-[3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl]phenyl]-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4S)-N-[3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl]phenyl]-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 124558496 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (1R,2R,4S)-N-[3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl]phenyl]-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | Cc1n[nH]c(C)c1NC(=O)c1cccc(NC(=O)[C@]2(C)C[C@H]3C=C[C@H]2C3)c1 |
| InChI | InChI=1S/C21H24N4O2/c1-12-18(13(2)25-24-12)23-19(26)15-5-4-6-17(10-15)22-20(27)21(3)11-14-7-8-16(21)9-14/h4-8,10,14,16H,9,11H2,1-3H3,(H,22,27)(H,23,26)(H,24,25)/t14-,16-,21+/m0/s1 |
| InChIKey | HQAQVMMEURRGKW-WDUKFBBWSA-N |
| XLogP | 3.82 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|