C27H28N4O2 — CID 21369238
N-[3-[(3,5-dimethyl-1-phenylpyrazol-4-yl)carbamoyl]phenyl]-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 21369238) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is N-[3-[(3,5-dimethyl-1-phenylpyrazol-4-yl)carbamoyl]phenyl]-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-[3-[(3,5-dimethyl-1-phenylpyrazol-4-yl)carbamoyl]phenyl]-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 21369238 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | N-[3-[(3,5-dimethyl-1-phenylpyrazol-4-yl)carbamoyl]phenyl]-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1NC(=O)c1cccc(NC(=O)C2(C)CC3C=CC2C3)c1 |
| InChI | InChI=1S/C27H28N4O2/c1-17-24(18(2)31(30-17)23-10-5-4-6-11-23)29-25(32)20-8-7-9-22(15-20)28-26(33)27(3)16-19-12-13-21(27)14-19/h4-13,15,19,21H,14,16H2,1-3H3,(H,28,33)(H,29,32) |
| InChIKey | ZQHTXOPPFPGPFW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|