C14H18F2O2S — CID 124565485
(2R)-2-[3-(2,4-difluorophenyl)sulfanylpropoxy]oxane (PubChem CID 124565485) has the molecular formula C14H18F2O2S and a molecular weight of 288.36 g/mol. Its IUPAC name is (2R)-2-[3-(2,4-difluorophenyl)sulfanylpropoxy]oxane.
| Compound Name | (2R)-2-[3-(2,4-difluorophenyl)sulfanylpropoxy]oxane |
|---|---|
| PubChem CID | 124565485 |
| Molecular Formula | C14H18F2O2S |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (2R)-2-[3-(2,4-difluorophenyl)sulfanylpropoxy]oxane |
| SMILES | Fc1ccc(SCCCO[C@@H]2CCCCO2)c(F)c1 |
| InChI | InChI=1S/C14H18F2O2S/c15-11-5-6-13(12(16)10-11)19-9-3-8-18-14-4-1-2-7-17-14/h5-6,10,14H,1-4,7-9H2/t14-/m1/s1 |
| InChIKey | APBKCBCPVSDREM-CQSZACIVSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|