C12H17N3O3 — CID 124567010
6-[[(1R,2S)-2-methylcyclohexyl]amino]-5-nitro-1H-pyridin-2-one (PubChem CID 124567010) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 6-[[(1R,2S)-2-methylcyclohexyl]amino]-5-nitro-1H-pyridin-2-one.
| Compound Name | 6-[[(1R,2S)-2-methylcyclohexyl]amino]-5-nitro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 124567010 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 6-[[(1R,2S)-2-methylcyclohexyl]amino]-5-nitro-1H-pyridin-2-one |
| SMILES | C[C@H]1CCCC[C@H]1Nc1[nH]c(=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N3O3/c1-8-4-2-3-5-9(8)13-12-10(15(17)18)6-7-11(16)14-12/h6-9H,2-5H2,1H3,(H2,13,14,16)/t8-,9+/m0/s1 |
| InChIKey | WDTXQCCQDZDOOI-DTWKUNHWSA-N |
| XLogP | 2.27 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|