C10H17NO — CID 124567047
(1S,6S)-N-ethylbicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 124567047) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (1S,6S)-N-ethylbicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1S,6S)-N-ethylbicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 124567047 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (1S,6S)-N-ethylbicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | CCNC(=O)C1[C@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C10H17NO/c1-2-11-10(12)9-7-5-3-4-6-8(7)9/h7-9H,2-6H2,1H3,(H,11,12)/t7-,8-/m0/s1 |
| InChIKey | VGEASRUWKDVMHR-YUMQZZPRSA-N |
| XLogP | 1.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |