C8H14N2O — CID 131207269
(1S,5R)-N-ethyl-3-azabicyclo[3.1.0]hexane-6-carboxamide (PubChem CID 131207269) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (1S,5R)-N-ethyl-3-azabicyclo[3.1.0]hexane-6-carboxamide.
| Compound Name | (1S,5R)-N-ethyl-3-azabicyclo[3.1.0]hexane-6-carboxamide |
|---|---|
| PubChem CID | 131207269 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (1S,5R)-N-ethyl-3-azabicyclo[3.1.0]hexane-6-carboxamide |
| SMILES | CCNC(=O)C1[C@H]2CNC[C@@H]12 |
| InChI | InChI=1S/C8H14N2O/c1-2-10-8(11)7-5-3-9-4-6(5)7/h5-7,9H,2-4H2,1H3,(H,10,11)/t5-,6+,7? |
| InChIKey | QZLMAGPGXZZSKW-MEKDEQNOSA-N |
| XLogP | -0.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |