C14H18N2O5S — CID 124568979
[(2S,3S)-2,3-dimethyl-1,1-dioxo-1,4-thiazinan-4-yl]-(2-methyl-4-nitrophenyl)methanone (PubChem CID 124568979) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is [(2S,3S)-2,3-dimethyl-1,1-dioxo-1,4-thiazinan-4-yl]-(2-methyl-4-nitrophenyl)methanone.
| Compound Name | [(2S,3S)-2,3-dimethyl-1,1-dioxo-1,4-thiazinan-4-yl]-(2-methyl-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 124568979 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | [(2S,3S)-2,3-dimethyl-1,1-dioxo-1,4-thiazinan-4-yl]-(2-methyl-4-nitrophenyl)methanone |
| SMILES | Cc1cc([N+](=O)[O-])ccc1C(=O)N1CCS(=O)(=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C14H18N2O5S/c1-9-8-12(16(18)19)4-5-13(9)14(17)15-6-7-22(20,21)11(3)10(15)2/h4-5,8,10-11H,6-7H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | SPSSEVDWYHYTSW-QWRGUYRKSA-N |
| XLogP | 1.55 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|