About (2R)-N-[(2S)-1-(3,4-dimethylphenyl)sulfanylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide
(2R)-N-[(2S)-1-(3,4-dimethylphenyl)sulfanylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 124569792) has the molecular formula C17H24N2O2S
and a molecular weight of 320.46 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-(3,4-dimethylphenyl)sulfanylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-N-[(2S)-1-(3,4-dimethylphenyl)sulfanylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide |
| PubChem CID | 124569792 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (2R)-N-[(2S)-1-(3,4-dimethylphenyl)sulfanylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | CC[C@@H](CSc1ccc(C)c(C)c1)NC(=O)[C@H]1CCC(=O)N1 |
| InChI | InChI=1S/C17H24N2O2S/c1-4-13(18-17(21)15-7-8-16(20)19-15)10-22-14-6-5-11(2)12(3)9-14/h5-6,9,13,15H,4,7-8,10H2,1-3H3,(H,18,21)(H,19,20)/t13-,15+/m0/s1 |
| InChIKey | WENRWXLTMRGKIT-DZGCQCFKSA-N |
| XLogP | 2.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-N-[(2S)-1-(3,4-dimethylphenyl)sulfanylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[(2S)-1-(3,4-dimethylphenyl)sulfanylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide?
The IUPAC name of (2R)-N-[(2S)-1-(3,4-dimethylphenyl)sulfanylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide (CID 124569792) is (2R)-N-[(2S)-1-(3,4-dimethylphenyl)sulfanylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide.
What is the SMILES notation for (2R)-N-[(2S)-1-(3,4-dimethylphenyl)sulfanylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide?
The canonical SMILES for (2R)-N-[(2S)-1-(3,4-dimethylphenyl)sulfanylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide is CC[C@@H](CSc1ccc(C)c(C)c1)NC(=O)[C@H]1CCC(=O)N1.
What is the InChIKey of (2R)-N-[(2S)-1-(3,4-dimethylphenyl)sulfanylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide?
The InChIKey is WENRWXLTMRGKIT-DZGCQCFKSA-N. The full InChI is InChI=1S/C17H24N2O2S/c1-4-13(18-17(21)15-7-8-16(20)19-15)10-22-14-6-5-11(2)12(3)9-14/h5-6,9,13,15H,4,7-8,10H2,1-3H3,(H,18,21)(H,19,20)/t13-,15+/m0/s1.
What are the key properties of (2R)-N-[(2S)-1-(3,4-dimethylphenyl)sulfanylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide?
(2R)-N-[(2S)-1-(3,4-dimethylphenyl)sulfanylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide has a molecular weight of 320.46 g/mol, XLogP of 2.57, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[(2S)-1-(3,4-dimethylphenyl)sulfanylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide is sourced from PubChem (CID 124569792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).