C12H13BrN2O2 — CID 43806476
N-(5-bromo-2-methylphenyl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 43806476) has the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-(5-bromo-2-methylphenyl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 43806476 |
| Molecular Formula | C12H13BrN2O2 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(Br)cc1NC(=O)C1CCC(=O)N1 |
| InChI | InChI=1S/C12H13BrN2O2/c1-7-2-3-8(13)6-10(7)15-12(17)9-4-5-11(16)14-9/h2-3,6,9H,4-5H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | ALWOHOWTKVGJPX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |