C13H17N3O4S — CID 60651450
N-(2,3-dimethyl-5-sulfamoylphenyl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 60651450) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is N-(2,3-dimethyl-5-sulfamoylphenyl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 60651450 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NC(=O)C2CCC(=O)N2)c1C |
| InChI | InChI=1S/C13H17N3O4S/c1-7-5-9(21(14,19)20)6-11(8(7)2)16-13(18)10-3-4-12(17)15-10/h5-6,10H,3-4H2,1-2H3,(H,15,17)(H,16,18)(H2,14,19,20) |
| InChIKey | LMQKSXKEQSFEIV-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |