C18H24BrN3O3 — CID 134459549
(2S)-N-[5-bromo-2-[(4-hydroxycyclohexyl)amino]phenyl]-6-oxopiperidine-2-carboxamide (PubChem CID 134459549) has the molecular formula C18H24BrN3O3 and a molecular weight of 410.31 g/mol. Its IUPAC name is (2S)-N-[5-bromo-2-[(4-hydroxycyclohexyl)amino]phenyl]-6-oxopiperidine-2-carboxamide.
| Compound Name | (2S)-N-[5-bromo-2-[(4-hydroxycyclohexyl)amino]phenyl]-6-oxopiperidine-2-carboxamide |
|---|---|
| PubChem CID | 134459549 |
| Molecular Formula | C18H24BrN3O3 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (2S)-N-[5-bromo-2-[(4-hydroxycyclohexyl)amino]phenyl]-6-oxopiperidine-2-carboxamide |
| SMILES | O=C1CCC[C@@H](C(=O)Nc2cc(Br)ccc2NC2CCC(O)CC2)N1 |
| InChI | InChI=1S/C18H24BrN3O3/c19-11-4-9-14(20-12-5-7-13(23)8-6-12)16(10-11)22-18(25)15-2-1-3-17(24)21-15/h4,9-10,12-13,15,20,23H,1-3,5-8H2,(H,21,24)(H,22,25)/t12?,13?,15-/m0/s1 |
| InChIKey | FVTKJKLQXXMEBI-PIMMBPRGSA-N |
| XLogP | 2.77 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |