C15H14BrN3O2 — CID 125135861
(2R)-N-(8-bromoquinolin-2-yl)-6-oxopiperidine-2-carboxamide (PubChem CID 125135861) has the molecular formula C15H14BrN3O2 and a molecular weight of 348.20 g/mol. Its IUPAC name is (2R)-N-(8-bromoquinolin-2-yl)-6-oxopiperidine-2-carboxamide.
| Compound Name | (2R)-N-(8-bromoquinolin-2-yl)-6-oxopiperidine-2-carboxamide |
|---|---|
| PubChem CID | 125135861 |
| Molecular Formula | C15H14BrN3O2 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | (2R)-N-(8-bromoquinolin-2-yl)-6-oxopiperidine-2-carboxamide |
| SMILES | O=C1CCC[C@H](C(=O)Nc2ccc3cccc(Br)c3n2)N1 |
| InChI | InChI=1S/C15H14BrN3O2/c16-10-4-1-3-9-7-8-12(18-14(9)10)19-15(21)11-5-2-6-13(20)17-11/h1,3-4,7-8,11H,2,5-6H2,(H,17,20)(H,18,19,21)/t11-/m1/s1 |
| InChIKey | NUFYHMMTSLNONL-LLVKDONJSA-N |
| XLogP | 2.60 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |