C13H15BrN2O2 — CID 97062756
(2S)-1-[(8-bromoquinolin-2-yl)amino]-3-methoxypropan-2-ol (PubChem CID 97062756) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is (2S)-1-[(8-bromoquinolin-2-yl)amino]-3-methoxypropan-2-ol.
| Compound Name | (2S)-1-[(8-bromoquinolin-2-yl)amino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 97062756 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | (2S)-1-[(8-bromoquinolin-2-yl)amino]-3-methoxypropan-2-ol |
| SMILES | COC[C@@H](O)CNc1ccc2cccc(Br)c2n1 |
| InChI | InChI=1S/C13H15BrN2O2/c1-18-8-10(17)7-15-12-6-5-9-3-2-4-11(14)13(9)16-12/h2-6,10,17H,7-8H2,1H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | PCPMOFHEZXVXRN-JTQLQIEISA-N |
| XLogP | 2.42 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |