About methyl 2-[[(2S)-2-[(3R,5S)-3,5-dimethylazepan-1-yl]propanoyl]amino]acetate
methyl 2-[[(2S)-2-[(3R,5S)-3,5-dimethylazepan-1-yl]propanoyl]amino]acetate (PubChem CID 124572172) has the molecular formula C14H26N2O3
and a molecular weight of 270.37 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-[(3R,5S)-3,5-dimethylazepan-1-yl]propanoyl]amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[[(2S)-2-[(3R,5S)-3,5-dimethylazepan-1-yl]propanoyl]amino]acetate |
| PubChem CID | 124572172 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | methyl 2-[[(2S)-2-[(3R,5S)-3,5-dimethylazepan-1-yl]propanoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)[C@H](C)N1CC[C@@H](C)C[C@@H](C)C1 |
| InChI | InChI=1S/C14H26N2O3/c1-10-5-6-16(9-11(2)7-10)12(3)14(18)15-8-13(17)19-4/h10-12H,5-9H2,1-4H3,(H,15,18)/t10-,11-,12+/m1/s1 |
| InChIKey | QGCGQDCTDKFIJT-UTUOFQBUSA-N |
| XLogP | 1.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[[(2S)-2-[(3R,5S)-3,5-dimethylazepan-1-yl]propanoyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(2S)-2-[(3R,5S)-3,5-dimethylazepan-1-yl]propanoyl]amino]acetate?
The IUPAC name of methyl 2-[[(2S)-2-[(3R,5S)-3,5-dimethylazepan-1-yl]propanoyl]amino]acetate (CID 124572172) is methyl 2-[[(2S)-2-[(3R,5S)-3,5-dimethylazepan-1-yl]propanoyl]amino]acetate.
What is the SMILES notation for methyl 2-[[(2S)-2-[(3R,5S)-3,5-dimethylazepan-1-yl]propanoyl]amino]acetate?
The canonical SMILES for methyl 2-[[(2S)-2-[(3R,5S)-3,5-dimethylazepan-1-yl]propanoyl]amino]acetate is COC(=O)CNC(=O)[C@H](C)N1CC[C@@H](C)C[C@@H](C)C1.
What is the InChIKey of methyl 2-[[(2S)-2-[(3R,5S)-3,5-dimethylazepan-1-yl]propanoyl]amino]acetate?
The InChIKey is QGCGQDCTDKFIJT-UTUOFQBUSA-N. The full InChI is InChI=1S/C14H26N2O3/c1-10-5-6-16(9-11(2)7-10)12(3)14(18)15-8-13(17)19-4/h10-12H,5-9H2,1-4H3,(H,15,18)/t10-,11-,12+/m1/s1.
What are the key properties of methyl 2-[[(2S)-2-[(3R,5S)-3,5-dimethylazepan-1-yl]propanoyl]amino]acetate?
methyl 2-[[(2S)-2-[(3R,5S)-3,5-dimethylazepan-1-yl]propanoyl]amino]acetate has a molecular weight of 270.37 g/mol, XLogP of 1.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(2S)-2-[(3R,5S)-3,5-dimethylazepan-1-yl]propanoyl]amino]acetate is sourced from PubChem (CID 124572172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).