C16H19N3OS — CID 124573434
N-[(3S)-1-pyridin-2-ylpiperidin-3-yl]-2-thiophen-3-ylacetamide (PubChem CID 124573434) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is N-[(3S)-1-pyridin-2-ylpiperidin-3-yl]-2-thiophen-3-ylacetamide.
| Compound Name | N-[(3S)-1-pyridin-2-ylpiperidin-3-yl]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 124573434 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-[(3S)-1-pyridin-2-ylpiperidin-3-yl]-2-thiophen-3-ylacetamide |
| SMILES | O=C(Cc1ccsc1)N[C@H]1CCCN(c2ccccn2)C1 |
| InChI | InChI=1S/C16H19N3OS/c20-16(10-13-6-9-21-12-13)18-14-4-3-8-19(11-14)15-5-1-2-7-17-15/h1-2,5-7,9,12,14H,3-4,8,10-11H2,(H,18,20)/t14-/m0/s1 |
| InChIKey | BFWBBYRLLSYKLV-AWEZNQCLSA-N |
| XLogP | 2.47 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |