C15H19N5O3 — CID 127247784
2-(2,5-dioxoimidazolidin-1-yl)-N-(1-pyridin-2-ylpiperidin-3-yl)acetamide (PubChem CID 127247784) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-1-yl)-N-(1-pyridin-2-ylpiperidin-3-yl)acetamide.
| Compound Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-(1-pyridin-2-ylpiperidin-3-yl)acetamide |
|---|---|
| PubChem CID | 127247784 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-(1-pyridin-2-ylpiperidin-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)CNC1=O)NC1CCCN(c2ccccn2)C1 |
| InChI | InChI=1S/C15H19N5O3/c21-13(10-20-14(22)8-17-15(20)23)18-11-4-3-7-19(9-11)12-5-1-2-6-16-12/h1-2,5-6,11H,3-4,7-10H2,(H,17,23)(H,18,21) |
| InChIKey | CJDBSBMBHPJITC-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|