C16H21N5O3 — CID 95896405
2-(2,5-dioxoimidazolidin-1-yl)-N-[(3S)-1-(pyridin-2-ylmethyl)piperidin-3-yl]acetamide (PubChem CID 95896405) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-1-yl)-N-[(3S)-1-(pyridin-2-ylmethyl)piperidin-3-yl]acetamide.
| Compound Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-[(3S)-1-(pyridin-2-ylmethyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 95896405 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-[(3S)-1-(pyridin-2-ylmethyl)piperidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)CNC1=O)N[C@H]1CCCN(Cc2ccccn2)C1 |
| InChI | InChI=1S/C16H21N5O3/c22-14(11-21-15(23)8-18-16(21)24)19-13-5-3-7-20(10-13)9-12-4-1-2-6-17-12/h1-2,4,6,13H,3,5,7-11H2,(H,18,24)(H,19,22)/t13-/m0/s1 |
| InChIKey | PVHIMWMNIQEPCH-ZDUSSCGKSA-N |
| XLogP | -0.29 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|