C19H22F2N4O — CID 96578894
1-(2,4-difluorophenyl)-3-[(3R)-1-(pyridin-2-ylmethyl)azepan-3-yl]urea (PubChem CID 96578894) has the molecular formula C19H22F2N4O and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[(3R)-1-(pyridin-2-ylmethyl)azepan-3-yl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[(3R)-1-(pyridin-2-ylmethyl)azepan-3-yl]urea |
|---|---|
| PubChem CID | 96578894 |
| Molecular Formula | C19H22F2N4O |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[(3R)-1-(pyridin-2-ylmethyl)azepan-3-yl]urea |
| SMILES | O=C(Nc1ccc(F)cc1F)N[C@@H]1CCCCN(Cc2ccccn2)C1 |
| InChI | InChI=1S/C19H22F2N4O/c20-14-7-8-18(17(21)11-14)24-19(26)23-16-6-2-4-10-25(13-16)12-15-5-1-3-9-22-15/h1,3,5,7-9,11,16H,2,4,6,10,12-13H2,(H2,23,24,26)/t16-/m1/s1 |
| InChIKey | ZMOLEYPZUCJONL-MRXNPFEDSA-N |
| XLogP | 3.54 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |