C17H17F2N3O — CID 136540145
N-(2,4-difluorophenyl)-2-(3-pyridin-2-ylpyrrolidin-1-yl)acetamide (PubChem CID 136540145) has the molecular formula C17H17F2N3O and a molecular weight of 317.34 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(3-pyridin-2-ylpyrrolidin-1-yl)acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(3-pyridin-2-ylpyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 136540145 |
| Molecular Formula | C17H17F2N3O |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(3-pyridin-2-ylpyrrolidin-1-yl)acetamide |
| SMILES | O=C(CN1CCC(c2ccccn2)C1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H17F2N3O/c18-13-4-5-16(14(19)9-13)21-17(23)11-22-8-6-12(10-22)15-3-1-2-7-20-15/h1-5,7,9,12H,6,8,10-11H2,(H,21,23) |
| InChIKey | ITLIGDBCDSCORS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |