C14H21NO4 — CID 124573623
methyl (2S)-2-[(2R)-2-[5-(methoxymethyl)furan-2-yl]pyrrolidin-1-yl]propanoate (PubChem CID 124573623) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is methyl (2S)-2-[(2R)-2-[5-(methoxymethyl)furan-2-yl]pyrrolidin-1-yl]propanoate.
| Compound Name | methyl (2S)-2-[(2R)-2-[5-(methoxymethyl)furan-2-yl]pyrrolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 124573623 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | methyl (2S)-2-[(2R)-2-[5-(methoxymethyl)furan-2-yl]pyrrolidin-1-yl]propanoate |
| SMILES | COCc1ccc([C@H]2CCCN2[C@@H](C)C(=O)OC)o1 |
| InChI | InChI=1S/C14H21NO4/c1-10(14(16)18-3)15-8-4-5-12(15)13-7-6-11(19-13)9-17-2/h6-7,10,12H,4-5,8-9H2,1-3H3/t10-,12+/m0/s1 |
| InChIKey | NEKNNBPTMOCWCT-CMPLNLGQSA-N |
| XLogP | 2.12 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |