C17H21NO3 — CID 99858079
4-[[(2R)-2-[5-(methoxymethyl)furan-2-yl]pyrrolidin-1-yl]methyl]phenol (PubChem CID 99858079) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-[[(2R)-2-[5-(methoxymethyl)furan-2-yl]pyrrolidin-1-yl]methyl]phenol.
| Compound Name | 4-[[(2R)-2-[5-(methoxymethyl)furan-2-yl]pyrrolidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 99858079 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-[[(2R)-2-[5-(methoxymethyl)furan-2-yl]pyrrolidin-1-yl]methyl]phenol |
| SMILES | COCc1ccc([C@H]2CCCN2Cc2ccc(O)cc2)o1 |
| InChI | InChI=1S/C17H21NO3/c1-20-12-15-8-9-17(21-15)16-3-2-10-18(16)11-13-4-6-14(19)7-5-13/h4-9,16,19H,2-3,10-12H2,1H3/t16-/m1/s1 |
| InChIKey | RNFKDQHNZDGJQW-MRXNPFEDSA-N |
| XLogP | 3.47 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |