C15H18N2O3S2 — CID 124575905
3-[[(4aR,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]sulfonylmethyl]benzonitrile (PubChem CID 124575905) has the molecular formula C15H18N2O3S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 3-[[(4aR,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]sulfonylmethyl]benzonitrile.
| Compound Name | 3-[[(4aR,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]sulfonylmethyl]benzonitrile |
|---|---|
| PubChem CID | 124575905 |
| Molecular Formula | C15H18N2O3S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 3-[[(4aR,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]sulfonylmethyl]benzonitrile |
| SMILES | N#Cc1cccc(CS(=O)(=O)N2CCS[C@H]3COCC[C@@H]32)c1 |
| InChI | InChI=1S/C15H18N2O3S2/c16-9-12-2-1-3-13(8-12)11-22(18,19)17-5-7-21-15-10-20-6-4-14(15)17/h1-3,8,14-15H,4-7,10-11H2/t14-,15-/m0/s1 |
| InChIKey | DRIZIFZRGLDWLA-GJZGRUSLSA-N |
| XLogP | 1.59 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |