C17H21N3O2S — CID 124784478
3-[[(3aR,6aS)-4-cyclopropylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]benzonitrile (PubChem CID 124784478) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 3-[[(3aR,6aS)-4-cyclopropylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[(3aR,6aS)-4-cyclopropylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 124784478 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 3-[[(3aR,6aS)-4-cyclopropylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2CC[C@@H]3[C@@H]2CCN3S(=O)(=O)C2CC2)c1 |
| InChI | InChI=1S/C17H21N3O2S/c18-11-13-2-1-3-14(10-13)12-19-8-6-17-16(19)7-9-20(17)23(21,22)15-4-5-15/h1-3,10,15-17H,4-9,12H2/t16-,17+/m0/s1 |
| InChIKey | MBIONSGPNBAWIK-DLBZAZTESA-N |
| XLogP | 1.70 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |