C23H20BrN3O5 — CID 124579574
N-[(3aS,7aR)-5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[(4-bromophenyl)methyl]-2-nitrobenzamide (PubChem CID 124579574) has the molecular formula C23H20BrN3O5 and a molecular weight of 498.33 g/mol. Its IUPAC name is N-[(3aS,7aR)-5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[(4-bromophenyl)methyl]-2-nitrobenzamide.
| Compound Name | N-[(3aS,7aR)-5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[(4-bromophenyl)methyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 124579574 |
| Molecular Formula | C23H20BrN3O5 |
| Molecular Weight | 498.33 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | N-[(3aS,7aR)-5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[(4-bromophenyl)methyl]-2-nitrobenzamide |
| SMILES | CC1=CC[C@H]2C(=O)N(N(Cc3ccc(Br)cc3)C(=O)c3ccccc3[N+](=O)[O-])C(=O)[C@H]2C1 |
| InChI | InChI=1S/C23H20BrN3O5/c1-14-6-11-17-19(12-14)23(30)26(22(17)29)25(13-15-7-9-16(24)10-8-15)21(28)18-4-2-3-5-20(18)27(31)32/h2-10,17,19H,11-13H2,1H3/t17-,19+/m1/s1 |
| InChIKey | BEHYGHQLYWVBFM-MJGOQNOKSA-N |
| XLogP | 4.26 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|