C17H12BrF3N2O5 — CID 86637965
methyl 2-[(4-bromophenyl)methyl-(2,2,2-trifluoroacetyl)amino]-3-nitrobenzoate (PubChem CID 86637965) has the molecular formula C17H12BrF3N2O5 and a molecular weight of 461.19 g/mol. Its IUPAC name is methyl 2-[(4-bromophenyl)methyl-(2,2,2-trifluoroacetyl)amino]-3-nitrobenzoate.
| Compound Name | methyl 2-[(4-bromophenyl)methyl-(2,2,2-trifluoroacetyl)amino]-3-nitrobenzoate |
|---|---|
| PubChem CID | 86637965 |
| Molecular Formula | C17H12BrF3N2O5 |
| Molecular Weight | 461.19 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | methyl 2-[(4-bromophenyl)methyl-(2,2,2-trifluoroacetyl)amino]-3-nitrobenzoate |
| SMILES | COC(=O)c1cccc([N+](=O)[O-])c1N(Cc1ccc(Br)cc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C17H12BrF3N2O5/c1-28-15(24)12-3-2-4-13(23(26)27)14(12)22(16(25)17(19,20)21)9-10-5-7-11(18)8-6-10/h2-8H,9H2,1H3 |
| InChIKey | WPPWPSHCLIKOIU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.19 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|